Statistics
241 human active and 13 inactive phosphatases in total;
194 phosphatases have substrate data;
--------------------------------
336 protein substrates;
83 non-protein substrates;
1215 dephosphorylation interactions;
--------------------------------
299 KEGG pathways;
876 Reactome pathways;
--------------------------------
last scientific update:
11 Mar, 2019
last maintenance update:
01 Sep, 2023
194 phosphatases have substrate data;
--------------------------------
336 protein substrates;
83 non-protein substrates;
1215 dephosphorylation interactions;
--------------------------------
299 KEGG pathways;
876 Reactome pathways;
--------------------------------
last scientific update:
11 Mar, 2019
last maintenance update:
01 Sep, 2023
CHEBI:17361
| Name | cytidine 5'-monophosphate |  Download: mol | sdf |
| Synonyms | 05'-cmp; 5'-o-phosphonatocytidine; Cmp; Cytidine 5'-monophosphate; Cytidine-5'-monophosphate; Cytidylate; Cytidylic acid; | |
| Definition | A pyrimidine ribonucleoside 5'-monophosphate having cytosine as the nucleobase. | |
| Molecular Weight (Exact mass) | 323.1965 (323.0519) | |
| Molecular Formula | C9H14N3O8P | |
| SMILES | Nc1ccn([C@@H]2O[C@H](COP(O)(O)=O)[C@@H](O)[C@H]2O)c(=O)n1 | |
| InChI | InChI=1S/C9H14N3O8P/c10-5-1-2-12(9(15)11-5)8-7(14)6(13)4(20-8)3-19-21(16,17)18/h1-2,4,6-8,13-14H,3H2,(H2,10,11,15)(H2,16,17,18)/t4-,6-,7-,8-/m1/s1 | |
| InChI Key | IERHLVCPSMICTF-XVFCMESISA-N | |
| Crosslinking annotations | KEGG:C00055 | 3DMET:B01141 | CAS:63-37-6 | ChEBI:17361 | ChEMBL:CHEMBL307679 | NIKKAJI:J60.869F | PDB-CCD:C | PDB-CCD:C5P | PubChem:3357 | |
Pathway ID  | Pathway Name | Pathway Description (KEGG) |
| map00240 | Pyrimidine metabolism | NA |
| map01100 | Metabolic pathways | NA |